C24H20N4 — CID 98520631
(1S,2S,3R,8R,9S,10S)-13,14-dimethylidene-4,7-dipyridin-2-yl-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-4,6,11-triene (PubChem CID 98520631) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is (1S,2S,3R,8R,9S,10S)-13,14-dimethylidene-4,7-dipyridin-2-yl-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-4,6,11-triene.
| Compound Name | (1S,2S,3R,8R,9S,10S)-13,14-dimethylidene-4,7-dipyridin-2-yl-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-4,6,11-triene |
|---|---|
| PubChem CID | 98520631 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (1S,2S,3R,8R,9S,10S)-13,14-dimethylidene-4,7-dipyridin-2-yl-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-4,6,11-triene |
| SMILES | C=C1C(=C)[C@H]2C=C[C@H]1[C@H]1[C@H]3C(c4ccccn4)=NN=C(c4ccccn4)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C24H20N4/c1-13-14(2)16-10-9-15(13)19-20(16)22-21(19)23(17-7-3-5-11-25-17)27-28-24(22)18-8-4-6-12-26-18/h3-12,15-16,19-22H,1-2H2/t15-,16-,19-,20-,21-,22-/m1/s1 |
| InChIKey | ZOZSHDLTHHXEOG-JYXLIDJPSA-N |
| XLogP | 4.09 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|