About di(pyrazin-2-yl)diazene
di(pyrazin-2-yl)diazene (PubChem CID 101239422) has the molecular formula C8H6N6
and a molecular weight of 186.18 g/mol. Its IUPAC name is di(pyrazin-2-yl)diazene.
Molecular Properties
| Compound Name | di(pyrazin-2-yl)diazene |
| PubChem CID | 101239422 |
| Molecular Formula | C8H6N6 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | di(pyrazin-2-yl)diazene |
| SMILES | c1cnc(/N=N/c2cnccn2)cn1 |
| InChI | InChI=1S/C8H6N6/c1-3-11-7(5-9-1)13-14-8-6-10-2-4-12-8/h1-6H/b14-13+ |
| InChIKey | QHAVOQCFQRKXBG-BUHFOSPRSA-N |
| XLogP | 1.68 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze di(pyrazin-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(pyrazin-2-yl)diazene?
The IUPAC name of di(pyrazin-2-yl)diazene (CID 101239422) is di(pyrazin-2-yl)diazene.
What is the SMILES notation for di(pyrazin-2-yl)diazene?
The canonical SMILES for di(pyrazin-2-yl)diazene is c1cnc(/N=N/c2cnccn2)cn1.
What is the InChIKey of di(pyrazin-2-yl)diazene?
The InChIKey is QHAVOQCFQRKXBG-BUHFOSPRSA-N. The full InChI is InChI=1S/C8H6N6/c1-3-11-7(5-9-1)13-14-8-6-10-2-4-12-8/h1-6H/b14-13+.
What are the key properties of di(pyrazin-2-yl)diazene?
di(pyrazin-2-yl)diazene has a molecular weight of 186.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for di(pyrazin-2-yl)diazene is sourced from PubChem (CID 101239422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).