About N-hydroxy-N'-pyrazin-2-ylpropanimidamide
N-hydroxy-N'-pyrazin-2-ylpropanimidamide (PubChem CID 137181777) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is N-hydroxy-N'-pyrazin-2-ylpropanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-pyrazin-2-ylpropanimidamide |
| PubChem CID | 137181777 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | N-hydroxy-N'-pyrazin-2-ylpropanimidamide |
| SMILES | CC/C(=N\c1cnccn1)NO |
| InChI | InChI=1S/C7H10N4O/c1-2-6(11-12)10-7-5-8-3-4-9-7/h3-5,12H,2H2,1H3,(H,9,10,11) |
| InChIKey | VIZNCXMMSBMWEQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-pyrazin-2-ylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-pyrazin-2-ylpropanimidamide?
The IUPAC name of N-hydroxy-N'-pyrazin-2-ylpropanimidamide (CID 137181777) is N-hydroxy-N'-pyrazin-2-ylpropanimidamide.
What is the SMILES notation for N-hydroxy-N'-pyrazin-2-ylpropanimidamide?
The canonical SMILES for N-hydroxy-N'-pyrazin-2-ylpropanimidamide is CC/C(=N\c1cnccn1)NO.
What is the InChIKey of N-hydroxy-N'-pyrazin-2-ylpropanimidamide?
The InChIKey is VIZNCXMMSBMWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-2-6(11-12)10-7-5-8-3-4-9-7/h3-5,12H,2H2,1H3,(H,9,10,11).
What are the key properties of N-hydroxy-N'-pyrazin-2-ylpropanimidamide?
N-hydroxy-N'-pyrazin-2-ylpropanimidamide has a molecular weight of 166.18 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-pyrazin-2-ylpropanimidamide is sourced from PubChem (CID 137181777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).