C10H15N3O4 — CID 101005436
(2S,3S,4S,5S)-1-pyrazin-2-yliminohexane-2,3,4,5-tetrol (PubChem CID 101005436) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-pyrazin-2-yliminohexane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S)-1-pyrazin-2-yliminohexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 101005436 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (2S,3S,4S,5S)-1-pyrazin-2-yliminohexane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)/C=N/c1cnccn1 |
| InChI | InChI=1S/C10H15N3O4/c1-6(14)9(16)10(17)7(15)4-13-8-5-11-2-3-12-8/h2-7,9-10,14-17H,1H3/b13-4+/t6-,7-,9-,10-/m0/s1 |
| InChIKey | FALSISBWBIPZLT-MUJLTKDCSA-N |
| XLogP | -1.36 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|