C18H22O3 — CID 101239822
(4aS,5S,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 101239822) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (4aS,5S,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5S,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 101239822 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (4aS,5S,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@]12CCC[C@H](C(=O)c3ccccc3)[C@@]1(O)CCCC2=O |
| InChI | InChI=1S/C18H22O3/c1-17-11-5-9-14(16(20)13-7-3-2-4-8-13)18(17,21)12-6-10-15(17)19/h2-4,7-8,14,21H,5-6,9-12H2,1H3/t14-,17-,18+/m1/s1 |
| InChIKey | GTTRHMZTEJZKOT-OLMNPRSZSA-N |
| XLogP | 3.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |