C24H42O14 — CID 101240045
10-O-ethenyl 1-O-[(2R,3R,4R,5S)-2,4,5,6-tetrahydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate (PubChem CID 101240045) has the molecular formula C24H42O14 and a molecular weight of 554.59 g/mol. Its IUPAC name is 10-O-ethenyl 1-O-[(2R,3R,4R,5S)-2,4,5,6-tetrahydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate.
| Compound Name | 10-O-ethenyl 1-O-[(2R,3R,4R,5S)-2,4,5,6-tetrahydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate |
|---|---|
| PubChem CID | 101240045 |
| Molecular Formula | C24H42O14 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 10-O-ethenyl 1-O-[(2R,3R,4R,5S)-2,4,5,6-tetrahydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate |
| SMILES | C=COC(=O)CCCCCCCCC(=O)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C24H42O14/c1-2-35-17(29)9-7-5-3-4-6-8-10-18(30)36-13-15(28)23(19(31)14(27)11-25)38-24-22(34)21(33)20(32)16(12-26)37-24/h2,14-16,19-28,31-34H,1,3-13H2/t14-,15+,16+,19+,20-,21-,22+,23+,24-/m0/s1 |
| InChIKey | NYVMRXAIJLFTGZ-IWVBHVEWSA-N |
| XLogP | -2.40 |
| TPSA | 232.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|