C24H42O13 — CID 11376109
10-O-ethenyl 1-O-[(2R,3S,5R)-2,5,6-trihydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate (PubChem CID 11376109) has the molecular formula C24H42O13 and a molecular weight of 538.59 g/mol. Its IUPAC name is 10-O-ethenyl 1-O-[(2R,3S,5R)-2,5,6-trihydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate.
| Compound Name | 10-O-ethenyl 1-O-[(2R,3S,5R)-2,5,6-trihydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate |
|---|---|
| PubChem CID | 11376109 |
| Molecular Formula | C24H42O13 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 10-O-ethenyl 1-O-[(2R,3S,5R)-2,5,6-trihydroxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl] decanedioate |
| SMILES | C=COC(=O)CCCCCCCCC(=O)OC[C@@H](O)[C@H](C[C@@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H42O13/c1-2-34-19(29)9-7-5-3-4-6-8-10-20(30)35-14-16(28)17(11-15(27)12-25)36-24-23(33)22(32)21(31)18(13-26)37-24/h2,15-18,21-28,31-33H,1,3-14H2/t15-,16-,17+,18-,21+,22+,23-,24-/m1/s1 |
| InChIKey | KUHROWXKKXZJSH-NOZDTBFJSA-N |
| XLogP | -1.37 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|