C34H16F10O4 — CID 101241503
dimethyl 4,5-bis(2,3,4,5,6-pentafluorophenyl)-3,6-diphenylbenzene-1,2-dicarboxylate (PubChem CID 101241503) has the molecular formula C34H16F10O4 and a molecular weight of 678.48 g/mol. Its IUPAC name is dimethyl 4,5-bis(2,3,4,5,6-pentafluorophenyl)-3,6-diphenylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4,5-bis(2,3,4,5,6-pentafluorophenyl)-3,6-diphenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101241503 |
| Molecular Formula | C34H16F10O4 |
| Molecular Weight | 678.48 g/mol |
| Exact Mass | 678.09 |
| IUPAC Name | dimethyl 4,5-bis(2,3,4,5,6-pentafluorophenyl)-3,6-diphenylbenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(-c2ccccc2)c(-c2c(F)c(F)c(F)c(F)c2F)c(-c2c(F)c(F)c(F)c(F)c2F)c1-c1ccccc1 |
| InChI | InChI=1S/C34H16F10O4/c1-47-33(45)19-15(13-9-5-3-6-10-13)17(21-23(35)27(39)31(43)28(40)24(21)36)18(22-25(37)29(41)32(44)30(42)26(22)38)16(20(19)34(46)48-2)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | VKTWXWSAYSQORM-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.48 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|