C23H26O2 — CID 101243551
9-(2-ethylhexyl)-9H-fluorene-3,6-dicarbaldehyde (PubChem CID 101243551) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 9-(2-ethylhexyl)-9H-fluorene-3,6-dicarbaldehyde.
| Compound Name | 9-(2-ethylhexyl)-9H-fluorene-3,6-dicarbaldehyde |
|---|---|
| PubChem CID | 101243551 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 9-(2-ethylhexyl)-9H-fluorene-3,6-dicarbaldehyde |
| SMILES | CCCCC(CC)CC1c2ccc(C=O)cc2-c2cc(C=O)ccc21 |
| InChI | InChI=1S/C23H26O2/c1-3-5-6-16(4-2)11-21-19-9-7-17(14-24)12-22(19)23-13-18(15-25)8-10-20(21)23/h7-10,12-16,21H,3-6,11H2,1-2H3 |
| InChIKey | MIEIJOOUYWLLEQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|