About 4-hexan-3-ylbenzaldehyde
4-hexan-3-ylbenzaldehyde (PubChem CID 142249319) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-hexan-3-ylbenzaldehyde.
Molecular Properties
| Compound Name | 4-hexan-3-ylbenzaldehyde |
| PubChem CID | 142249319 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-hexan-3-ylbenzaldehyde |
| SMILES | CCCC(CC)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H18O/c1-3-5-12(4-2)13-8-6-11(10-14)7-9-13/h6-10,12H,3-5H2,1-2H3 |
| InChIKey | ADLJFRSETSMBLP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hexan-3-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexan-3-ylbenzaldehyde?
The IUPAC name of 4-hexan-3-ylbenzaldehyde (CID 142249319) is 4-hexan-3-ylbenzaldehyde.
What is the SMILES notation for 4-hexan-3-ylbenzaldehyde?
The canonical SMILES for 4-hexan-3-ylbenzaldehyde is CCCC(CC)c1ccc(C=O)cc1.
What is the InChIKey of 4-hexan-3-ylbenzaldehyde?
The InChIKey is ADLJFRSETSMBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-3-5-12(4-2)13-8-6-11(10-14)7-9-13/h6-10,12H,3-5H2,1-2H3.
What are the key properties of 4-hexan-3-ylbenzaldehyde?
4-hexan-3-ylbenzaldehyde has a molecular weight of 190.29 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexan-3-ylbenzaldehyde is sourced from PubChem (CID 142249319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).