About 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene
4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene (PubChem CID 157461357) has the molecular formula C27H40O
and a molecular weight of 380.62 g/mol. Its IUPAC name is 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene.
Molecular Properties
| Compound Name | 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene |
| PubChem CID | 157461357 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene |
| SMILES | CCCC(CCC)c1ccc(C=O)cc1.CCCC(CCC)c1ccccc1 |
| InChI | InChI=1S/C14H20O.C13H20/c1-3-5-13(6-4-2)14-9-7-12(11-15)8-10-14;1-3-8-12(9-4-2)13-10-6-5-7-11-13/h7-11,13H,3-6H2,1-2H3;5-7,10-12H,3-4,8-9H2,1-2H3 |
| InChIKey | BTYQRCACGCZYGO-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene?
The IUPAC name of 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene (CID 157461357) is 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene.
What is the SMILES notation for 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene?
The canonical SMILES for 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene is CCCC(CCC)c1ccc(C=O)cc1.CCCC(CCC)c1ccccc1.
What is the InChIKey of 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene?
The InChIKey is BTYQRCACGCZYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O.C13H20/c1-3-5-13(6-4-2)14-9-7-12(11-15)8-10-14;1-3-8-12(9-4-2)13-10-6-5-7-11-13/h7-11,13H,3-6H2,1-2H3;5-7,10-12H,3-4,8-9H2,1-2H3.
What are the key properties of 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene?
4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene has a molecular weight of 380.62 g/mol, XLogP of 8.55, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-4-ylbenzaldehyde;heptan-4-ylbenzene is sourced from PubChem (CID 157461357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).