About 4-hexan-3-ylbenzenethiol
4-hexan-3-ylbenzenethiol (PubChem CID 69434915) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is 4-hexan-3-ylbenzenethiol.
Molecular Properties
| Compound Name | 4-hexan-3-ylbenzenethiol |
| PubChem CID | 69434915 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-hexan-3-ylbenzenethiol |
| SMILES | CCCC(CC)c1ccc(S)cc1 |
| InChI | InChI=1S/C12H18S/c1-3-5-10(4-2)11-6-8-12(13)9-7-11/h6-10,13H,3-5H2,1-2H3 |
| InChIKey | AQPZSSQCDZMMQC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hexan-3-ylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexan-3-ylbenzenethiol?
The IUPAC name of 4-hexan-3-ylbenzenethiol (CID 69434915) is 4-hexan-3-ylbenzenethiol.
What is the SMILES notation for 4-hexan-3-ylbenzenethiol?
The canonical SMILES for 4-hexan-3-ylbenzenethiol is CCCC(CC)c1ccc(S)cc1.
What is the InChIKey of 4-hexan-3-ylbenzenethiol?
The InChIKey is AQPZSSQCDZMMQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18S/c1-3-5-10(4-2)11-6-8-12(13)9-7-11/h6-10,13H,3-5H2,1-2H3.
What are the key properties of 4-hexan-3-ylbenzenethiol?
4-hexan-3-ylbenzenethiol has a molecular weight of 194.34 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexan-3-ylbenzenethiol is sourced from PubChem (CID 69434915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).