About 4-(4-aminophenyl)hexanal
4-(4-aminophenyl)hexanal (PubChem CID 54258952) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(4-aminophenyl)hexanal.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)hexanal |
| PubChem CID | 54258952 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(4-aminophenyl)hexanal |
| SMILES | CCC(CCC=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H17NO/c1-2-10(4-3-9-14)11-5-7-12(13)8-6-11/h5-10H,2-4,13H2,1H3 |
| InChIKey | YNTWRYADFTYVQU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)hexanal?
The IUPAC name of 4-(4-aminophenyl)hexanal (CID 54258952) is 4-(4-aminophenyl)hexanal.
What is the SMILES notation for 4-(4-aminophenyl)hexanal?
The canonical SMILES for 4-(4-aminophenyl)hexanal is CCC(CCC=O)c1ccc(N)cc1.
What is the InChIKey of 4-(4-aminophenyl)hexanal?
The InChIKey is YNTWRYADFTYVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-10(4-3-9-14)11-5-7-12(13)8-6-11/h5-10H,2-4,13H2,1H3.
What are the key properties of 4-(4-aminophenyl)hexanal?
4-(4-aminophenyl)hexanal has a molecular weight of 191.27 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)hexanal is sourced from PubChem (CID 54258952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).