C18H24N2 — CID 6990315
4-[(3R,4R)-4-(4-aminophenyl)hexan-3-yl]aniline (PubChem CID 6990315) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(3R,4R)-4-(4-aminophenyl)hexan-3-yl]aniline.
| Compound Name | 4-[(3R,4R)-4-(4-aminophenyl)hexan-3-yl]aniline |
|---|---|
| PubChem CID | 6990315 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-[(3R,4R)-4-(4-aminophenyl)hexan-3-yl]aniline |
| SMILES | CC[C@@H](c1ccc(N)cc1)[C@@H](CC)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H24N2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-18H,3-4,19-20H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | YORVBACNZYWHKD-ROUUACIJSA-N |
| XLogP | 4.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|