About CID 177385381
CID 177385381 (PubChem CID 177385381) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol.
Molecular Properties
| Compound Name | CID 177385381 |
| PubChem CID | 177385381 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | — |
| SMILES | CCC(c1ccc([O])cc1)C(CC)c1ccc([O])cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-18H,3-4H2,1-2H3 |
| InChIKey | OGJMFNGKKNAHJS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 39.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 177385381 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177385381?
The IUPAC name of CID 177385381 (CID 177385381) is not available.
What is the SMILES notation for CID 177385381?
The canonical SMILES for CID 177385381 is CCC(c1ccc([O])cc1)C(CC)c1ccc([O])cc1.
What is the InChIKey of CID 177385381?
The InChIKey is OGJMFNGKKNAHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-18H,3-4H2,1-2H3.
What are the key properties of CID 177385381?
CID 177385381 has a molecular weight of 268.36 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177385381 is sourced from PubChem (CID 177385381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).