C25H22F5N3 — CID 101244110
N,N-diethyl-4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 101244110) has the molecular formula C25H22F5N3 and a molecular weight of 459.46 g/mol. Its IUPAC name is N,N-diethyl-4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | N,N-diethyl-4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 101244110 |
| Molecular Formula | C25H22F5N3 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N,N-diethyl-4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | CCN(CC)c1ccc([C@@H]2CC(c3ccccc3)=NN2c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H22F5N3/c1-3-32(4-2)17-12-10-16(11-13-17)19-14-18(15-8-6-5-7-9-15)31-33(19)25-23(29)21(27)20(26)22(28)24(25)30/h5-13,19H,3-4,14H2,1-2H3/t19-/m0/s1 |
| InChIKey | HPGUAMUWGASRRE-IBGZPJMESA-N |
| XLogP | 6.58 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|