C13H21NO5 — CID 101245367
methyl (2E,4S)-2-ethylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate (PubChem CID 101245367) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is methyl (2E,4S)-2-ethylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate.
| Compound Name | methyl (2E,4S)-2-ethylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate |
|---|---|
| PubChem CID | 101245367 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | methyl (2E,4S)-2-ethylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopentanoate |
| SMILES | C/C=C(/C(=O)OC)C(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO5/c1-7-9(11(16)18-6)10(15)8(2)14-12(17)19-13(3,4)5/h7-8H,1-6H3,(H,14,17)/b9-7+/t8-/m0/s1 |
| InChIKey | MWXHFXVIRWPMQH-INTFFVIUSA-N |
| XLogP | 1.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|