About 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol
3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol (PubChem CID 101245603) has the molecular formula C14H18F4O4
and a molecular weight of 326.29 g/mol. Its IUPAC name is 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol |
| PubChem CID | 101245603 |
| Molecular Formula | C14H18F4O4 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)COCc1cccc(COCC(F)(F)CO)c1 |
| InChI | InChI=1S/C14H18F4O4/c15-13(16,7-19)9-21-5-11-2-1-3-12(4-11)6-22-10-14(17,18)8-20/h1-4,19-20H,5-10H2 |
| InChIKey | YFRPPWHMKRDKMA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol (CID 101245603) is 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol is OCC(F)(F)COCc1cccc(COCC(F)(F)CO)c1.
What is the InChIKey of 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol?
The InChIKey is YFRPPWHMKRDKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F4O4/c15-13(16,7-19)9-21-5-11-2-1-3-12(4-11)6-22-10-14(17,18)8-20/h1-4,19-20H,5-10H2.
What are the key properties of 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol?
3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol has a molecular weight of 326.29 g/mol, XLogP of 1.98, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-[(2,2-difluoro-3-hydroxypropoxy)methyl]phenyl]methoxy]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 101245603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).