C33H32I4O4 — CID 101115926
1-iodo-3-[[3-[(3-iodophenyl)methoxy]-2,2-bis[(3-iodophenyl)methoxymethyl]propoxy]methyl]benzene (PubChem CID 101115926) has the molecular formula C33H32I4O4 and a molecular weight of 1000.23 g/mol. Its IUPAC name is 1-iodo-3-[[3-[(3-iodophenyl)methoxy]-2,2-bis[(3-iodophenyl)methoxymethyl]propoxy]methyl]benzene.
| Compound Name | 1-iodo-3-[[3-[(3-iodophenyl)methoxy]-2,2-bis[(3-iodophenyl)methoxymethyl]propoxy]methyl]benzene |
|---|---|
| PubChem CID | 101115926 |
| Molecular Formula | C33H32I4O4 |
| Molecular Weight | 1000.23 g/mol |
| Exact Mass | 999.85 |
| IUPAC Name | 1-iodo-3-[[3-[(3-iodophenyl)methoxy]-2,2-bis[(3-iodophenyl)methoxymethyl]propoxy]methyl]benzene |
| SMILES | Ic1cccc(COCC(COCc2cccc(I)c2)(COCc2cccc(I)c2)COCc2cccc(I)c2)c1 |
| InChI | InChI=1S/C33H32I4O4/c34-29-9-1-5-25(13-29)17-38-21-33(22-39-18-26-6-2-10-30(35)14-26,23-40-19-27-7-3-11-31(36)15-27)24-41-20-28-8-4-12-32(37)16-28/h1-16H,17-24H2 |
| InChIKey | YYSCNVQDLYJFPX-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.23 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|