About (3-iodophenyl)methyl hypoiodite
(3-iodophenyl)methyl hypoiodite (PubChem CID 167240125) has the molecular formula C7H6I2O
and a molecular weight of 359.93 g/mol. Its IUPAC name is (3-iodophenyl)methyl hypoiodite.
Molecular Properties
| Compound Name | (3-iodophenyl)methyl hypoiodite |
| PubChem CID | 167240125 |
| Molecular Formula | C7H6I2O |
| Molecular Weight | 359.93 g/mol |
| Exact Mass | 359.85 |
| IUPAC Name | (3-iodophenyl)methyl hypoiodite |
| SMILES | IOCc1cccc(I)c1 |
| InChI | InChI=1S/C7H6I2O/c8-7-3-1-2-6(4-7)5-10-9/h1-4H,5H2 |
| InChIKey | FWCRKEAPFZZODU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.93 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl)methyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl)methyl hypoiodite?
The IUPAC name of (3-iodophenyl)methyl hypoiodite (CID 167240125) is (3-iodophenyl)methyl hypoiodite.
What is the SMILES notation for (3-iodophenyl)methyl hypoiodite?
The canonical SMILES for (3-iodophenyl)methyl hypoiodite is IOCc1cccc(I)c1.
What is the InChIKey of (3-iodophenyl)methyl hypoiodite?
The InChIKey is FWCRKEAPFZZODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6I2O/c8-7-3-1-2-6(4-7)5-10-9/h1-4H,5H2.
What are the key properties of (3-iodophenyl)methyl hypoiodite?
(3-iodophenyl)methyl hypoiodite has a molecular weight of 359.93 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl)methyl hypoiodite is sourced from PubChem (CID 167240125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).