About (3-iodophenyl)methyl hydrogen sulfite
(3-iodophenyl)methyl hydrogen sulfite (PubChem CID 174745935) has the molecular formula C7H7IO3S
and a molecular weight of 298.10 g/mol. Its IUPAC name is (3-iodophenyl)methyl hydrogen sulfite.
Molecular Properties
| Compound Name | (3-iodophenyl)methyl hydrogen sulfite |
| PubChem CID | 174745935 |
| Molecular Formula | C7H7IO3S |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | (3-iodophenyl)methyl hydrogen sulfite |
| SMILES | O=S(O)OCc1cccc(I)c1 |
| InChI | InChI=1S/C7H7IO3S/c8-7-3-1-2-6(4-7)5-11-12(9)10/h1-4H,5H2,(H,9,10) |
| InChIKey | LOPWQUMLHZKQIU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl)methyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl)methyl hydrogen sulfite?
The IUPAC name of (3-iodophenyl)methyl hydrogen sulfite (CID 174745935) is (3-iodophenyl)methyl hydrogen sulfite.
What is the SMILES notation for (3-iodophenyl)methyl hydrogen sulfite?
The canonical SMILES for (3-iodophenyl)methyl hydrogen sulfite is O=S(O)OCc1cccc(I)c1.
What is the InChIKey of (3-iodophenyl)methyl hydrogen sulfite?
The InChIKey is LOPWQUMLHZKQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IO3S/c8-7-3-1-2-6(4-7)5-11-12(9)10/h1-4H,5H2,(H,9,10).
What are the key properties of (3-iodophenyl)methyl hydrogen sulfite?
(3-iodophenyl)methyl hydrogen sulfite has a molecular weight of 298.10 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl)methyl hydrogen sulfite is sourced from PubChem (CID 174745935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).