C7H6IO5P2+ — CID 18547286
2-[(3-iodophenyl)methoxy]-1,3,2λ5,4-dioxadiphosphetan-4-ium 2,4-dioxide (PubChem CID 18547286) has the molecular formula C7H6IO5P2+ and a molecular weight of 358.97 g/mol. Its IUPAC name is 2-[(3-iodophenyl)methoxy]-1,3,2λ5,4-dioxadiphosphetan-4-ium 2,4-dioxide.
| Compound Name | 2-[(3-iodophenyl)methoxy]-1,3,2λ5,4-dioxadiphosphetan-4-ium 2,4-dioxide |
|---|---|
| PubChem CID | 18547286 |
| Molecular Formula | C7H6IO5P2+ |
| Molecular Weight | 358.97 g/mol |
| Exact Mass | 358.87 |
| IUPAC Name | 2-[(3-iodophenyl)methoxy]-1,3,2λ5,4-dioxadiphosphetan-4-ium 2,4-dioxide |
| SMILES | O=[P+]1OP(=O)(OCc2cccc(I)c2)O1 |
| InChI | InChI=1S/C7H6IO5P2/c8-7-3-1-2-6(4-7)5-11-15(10)12-14(9)13-15/h1-4H,5H2/q+1 |
| InChIKey | INOWEPNESIIDHR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|