C15H19ClF2O9 — CID 101246780
[(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[chloro(difluoro)methyl]oxan-2-yl]methyl acetate (PubChem CID 101246780) has the molecular formula C15H19ClF2O9 and a molecular weight of 416.76 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[chloro(difluoro)methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[chloro(difluoro)methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101246780 |
| Molecular Formula | C15H19ClF2O9 |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,6-triacetyloxy-5-[chloro(difluoro)methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](C(F)(F)Cl)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H19ClF2O9/c1-6(19)23-5-10-12(24-7(2)20)13(25-8(3)21)11(15(16,17)18)14(27-10)26-9(4)22/h10-14H,5H2,1-4H3/t10-,11-,12-,13-,14?/m1/s1 |
| InChIKey | FMEUQHUKQCWCOH-GNMOMJPPSA-N |
| XLogP | 1.15 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|