C13H16F4O8 — CID 14311474
[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-fluoro-6-(trifluoromethoxy)oxan-2-yl]methyl acetate (PubChem CID 14311474) has the molecular formula C13H16F4O8 and a molecular weight of 376.26 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-fluoro-6-(trifluoromethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-fluoro-6-(trifluoromethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14311474 |
| Molecular Formula | C13H16F4O8 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-fluoro-6-(trifluoromethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(F)(F)F)[C@H](F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H16F4O8/c1-5(18)21-4-8-10(22-6(2)19)11(23-7(3)20)9(14)12(24-8)25-13(15,16)17/h8-12H,4H2,1-3H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | VAQNZTSMXWSIJY-LZQZFOIKSA-N |
| XLogP | 1.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|