C30H23Cl2NO3S — CID 101247101
1,3-bis(4-chlorophenyl)-2-(4-hydroxy-3,5-diphenyl-1,3-thiazolidin-2-yl)propane-1,3-dione (PubChem CID 101247101) has the molecular formula C30H23Cl2NO3S and a molecular weight of 548.49 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-2-(4-hydroxy-3,5-diphenyl-1,3-thiazolidin-2-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(4-chlorophenyl)-2-(4-hydroxy-3,5-diphenyl-1,3-thiazolidin-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 101247101 |
| Molecular Formula | C30H23Cl2NO3S |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-2-(4-hydroxy-3,5-diphenyl-1,3-thiazolidin-2-yl)propane-1,3-dione |
| SMILES | O=C(c1ccc(Cl)cc1)C(C(=O)c1ccc(Cl)cc1)C1SC(c2ccccc2)C(O)N1c1ccccc1 |
| InChI | InChI=1S/C30H23Cl2NO3S/c31-22-15-11-19(12-16-22)26(34)25(27(35)20-13-17-23(32)18-14-20)30-33(24-9-5-2-6-10-24)29(36)28(37-30)21-7-3-1-4-8-21/h1-18,25,28-30,36H |
| InChIKey | PAHSYGDAZXTSLE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|