C16H15ClO4 — CID 174917583
1-(4-chlorophenyl)-2,2-dihydroxyethanone;1-phenylethanone (PubChem CID 174917583) has the molecular formula C16H15ClO4 and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-dihydroxyethanone;1-phenylethanone.
| Compound Name | 1-(4-chlorophenyl)-2,2-dihydroxyethanone;1-phenylethanone |
|---|---|
| PubChem CID | 174917583 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-dihydroxyethanone;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(c1ccc(Cl)cc1)C(O)O |
| InChI | InChI=1S/C8H7ClO3.C8H8O/c9-6-3-1-5(2-4-6)7(10)8(11)12;1-7(9)8-5-3-2-4-6-8/h1-4,8,11-12H;2-6H,1H3 |
| InChIKey | APCAZILLMFBNLT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|