C16H15F3O2 — CID 101247934
2,2,2-trifluoroethyl (1R,2S,3S,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101247934) has the molecular formula C16H15F3O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1R,2S,3S,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1R,2S,3S,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101247934 |
| Molecular Formula | C16H15F3O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2,2,2-trifluoroethyl (1R,2S,3S,4S)-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)F)[C@@H]1[C@@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H15F3O2/c17-16(18,19)9-21-15(20)14-12-7-6-11(8-12)13(14)10-4-2-1-3-5-10/h1-7,11-14H,8-9H2/t11-,12+,13+,14+/m1/s1 |
| InChIKey | MIBNDGPDCAWIDW-RFGFWPKPSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|