C33H34O7S — CID 101249013
(3S,5R,6R,7R,8S,13R)-13-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,4,12-trioxa-9-thiatricyclo[8.4.0.03,8]tetradec-1(10)-en-11-one (PubChem CID 101249013) has the molecular formula C33H34O7S and a molecular weight of 574.70 g/mol. Its IUPAC name is (3S,5R,6R,7R,8S,13R)-13-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,4,12-trioxa-9-thiatricyclo[8.4.0.03,8]tetradec-1(10)-en-11-one.
| Compound Name | (3S,5R,6R,7R,8S,13R)-13-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,4,12-trioxa-9-thiatricyclo[8.4.0.03,8]tetradec-1(10)-en-11-one |
|---|---|
| PubChem CID | 101249013 |
| Molecular Formula | C33H34O7S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | (3S,5R,6R,7R,8S,13R)-13-methyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,4,12-trioxa-9-thiatricyclo[8.4.0.03,8]tetradec-1(10)-en-11-one |
| SMILES | C[C@@H]1CC2=C(S[C@@H]3[C@H](O2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]3OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C33H34O7S/c1-22-17-26-30(32(34)38-22)41-31-29(37-20-25-15-9-4-10-16-25)28(36-19-24-13-7-3-8-14-24)27(40-33(31)39-26)21-35-18-23-11-5-2-6-12-23/h2-16,22,27-29,31,33H,17-21H2,1H3/t22-,27-,28-,29-,31+,33-/m1/s1 |
| InChIKey | XFVQGEZFZVOQPS-DBQKTCBASA-N |
| XLogP | 5.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |