C31H30O7S — CID 101249014
(1S,9S,11R,12R,13S)-12,13-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-5,8,10-trioxa-2-thiatricyclo[7.4.0.03,7]tridec-3(7)-en-4-one (PubChem CID 101249014) has the molecular formula C31H30O7S and a molecular weight of 546.64 g/mol. Its IUPAC name is (1S,9S,11R,12R,13S)-12,13-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-5,8,10-trioxa-2-thiatricyclo[7.4.0.03,7]tridec-3(7)-en-4-one.
| Compound Name | (1S,9S,11R,12R,13S)-12,13-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-5,8,10-trioxa-2-thiatricyclo[7.4.0.03,7]tridec-3(7)-en-4-one |
|---|---|
| PubChem CID | 101249014 |
| Molecular Formula | C31H30O7S |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (1S,9S,11R,12R,13S)-12,13-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-5,8,10-trioxa-2-thiatricyclo[7.4.0.03,7]tridec-3(7)-en-4-one |
| SMILES | O=C1OCC2=C1S[C@@H]1[C@H](O2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H30O7S/c32-30-28-25(20-36-30)38-31-29(39-28)27(35-18-23-14-8-3-9-15-23)26(34-17-22-12-6-2-7-13-22)24(37-31)19-33-16-21-10-4-1-5-11-21/h1-15,24,26-27,29,31H,16-20H2/t24-,26-,27+,29+,31+/m1/s1 |
| InChIKey | SMODYRIXLLYXFX-PXMYPKIMSA-N |
| XLogP | 5.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |