C21H31NO2 — CID 101249472
2-[(2R,4aS,4bS,8S,8aS,10aS)-8-(2-cyanoethyl)-4a-methyl-7-methylidene-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]acetic acid (PubChem CID 101249472) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 2-[(2R,4aS,4bS,8S,8aS,10aS)-8-(2-cyanoethyl)-4a-methyl-7-methylidene-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]acetic acid.
| Compound Name | 2-[(2R,4aS,4bS,8S,8aS,10aS)-8-(2-cyanoethyl)-4a-methyl-7-methylidene-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]acetic acid |
|---|---|
| PubChem CID | 101249472 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-[(2R,4aS,4bS,8S,8aS,10aS)-8-(2-cyanoethyl)-4a-methyl-7-methylidene-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthren-2-yl]acetic acid |
| SMILES | C=C1CC[C@H]2[C@@H](CC[C@H]3C[C@H](CC(=O)O)CC[C@@]32C)[C@@H]1CCC#N |
| InChI | InChI=1S/C21H31NO2/c1-14-5-8-19-18(17(14)4-3-11-22)7-6-16-12-15(13-20(23)24)9-10-21(16,19)2/h15-19H,1,3-10,12-13H2,2H3,(H,23,24)/t15-,16+,17-,18+,19+,21+/m1/s1 |
| InChIKey | IUEGORJZYLCTGG-JJMGOROYSA-N |
| XLogP | 5.18 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|