C12H23O3P — CID 101249807
trans-(2R,3R)-1-di(propan-2-yloxy)phosphoryl-2-ethenyl-3-methylcyclopropane (PubChem CID 101249807) has the molecular formula C12H23O3P and a molecular weight of 246.29 g/mol. Its IUPAC name is trans-(2R,3R)-1-di(propan-2-yloxy)phosphoryl-2-ethenyl-3-methylcyclopropane.
| Compound Name | trans-(2R,3R)-1-di(propan-2-yloxy)phosphoryl-2-ethenyl-3-methylcyclopropane |
|---|---|
| PubChem CID | 101249807 |
| Molecular Formula | C12H23O3P |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | trans-(2R,3R)-1-di(propan-2-yloxy)phosphoryl-2-ethenyl-3-methylcyclopropane |
| SMILES | C=C[C@H]1C(P(=O)(OC(C)C)OC(C)C)[C@@H]1C |
| InChI | InChI=1S/C12H23O3P/c1-7-11-10(6)12(11)16(13,14-8(2)3)15-9(4)5/h7-12H,1H2,2-6H3/t10-,11-,12?/m1/s1 |
| InChIKey | SCRZFBUAQBAYDF-XFKKCKKNSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|