C11H21O3P — CID 138983871
2-[(E)-2-diethoxyphosphorylethenyl]-1,1-dimethylcyclopropane (PubChem CID 138983871) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-[(E)-2-diethoxyphosphorylethenyl]-1,1-dimethylcyclopropane.
| Compound Name | 2-[(E)-2-diethoxyphosphorylethenyl]-1,1-dimethylcyclopropane |
|---|---|
| PubChem CID | 138983871 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[(E)-2-diethoxyphosphorylethenyl]-1,1-dimethylcyclopropane |
| SMILES | CCOP(=O)(/C=C/C1CC1(C)C)OCC |
| InChI | InChI=1S/C11H21O3P/c1-5-13-15(12,14-6-2)8-7-10-9-11(10,3)4/h7-8,10H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | QVOVXNSGCUEDAG-BQYQJAHWSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|