C14H18F6O5 — CID 101251055
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy)oct-7-enyl acetate (PubChem CID 101251055) has the molecular formula C14H18F6O5 and a molecular weight of 380.28 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy)oct-7-enyl acetate.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy)oct-7-enyl acetate |
|---|---|
| PubChem CID | 101251055 |
| Molecular Formula | C14H18F6O5 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyloxy)oct-7-enyl acetate |
| SMILES | C=CC(CCCCCOC(C)=O)OC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O5/c1-3-10(7-5-4-6-8-23-9(2)21)24-12(22)25-11(13(15,16)17)14(18,19)20/h3,10-11H,1,4-8H2,2H3 |
| InChIKey | PPNNPINAHLQTQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|