C16H24F6O3 — CID 134889383
[(3S)-dodec-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate (PubChem CID 134889383) has the molecular formula C16H24F6O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is [(3S)-dodec-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate.
| Compound Name | [(3S)-dodec-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate |
|---|---|
| PubChem CID | 134889383 |
| Molecular Formula | C16H24F6O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(3S)-dodec-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate |
| SMILES | C=C[C@H](CCCCCCCCC)OC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H24F6O3/c1-3-5-6-7-8-9-10-11-12(4-2)24-14(23)25-13(15(17,18)19)16(20,21)22/h4,12-13H,2-3,5-11H2,1H3/t12-/m1/s1 |
| InChIKey | VFVPYAYKTKMCNZ-GFCCVEGCSA-N |
| XLogP | 6.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|