C18H30F6O4Si — CID 134889507
[(3S)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate (PubChem CID 134889507) has the molecular formula C18H30F6O4Si and a molecular weight of 452.51 g/mol. Its IUPAC name is [(3S)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate.
| Compound Name | [(3S)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate |
|---|---|
| PubChem CID | 134889507 |
| Molecular Formula | C18H30F6O4Si |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(3S)-8-[tert-butyl(dimethyl)silyl]oxyoct-1-en-3-yl] 1,1,1,3,3,3-hexafluoropropan-2-yl carbonate |
| SMILES | C=C[C@H](CCCCCO[Si](C)(C)C(C)(C)C)OC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H30F6O4Si/c1-7-13(11-9-8-10-12-26-29(5,6)16(2,3)4)27-15(25)28-14(17(19,20)21)18(22,23)24/h7,13-14H,1,8-12H2,2-6H3/t13-/m1/s1 |
| InChIKey | OGIPHVXPXZJUED-CYBMUJFWSA-N |
| XLogP | 6.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|