About methyl undec-1-en-3-yl carbonate
methyl undec-1-en-3-yl carbonate (PubChem CID 86041216) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl undec-1-en-3-yl carbonate.
Molecular Properties
| Compound Name | methyl undec-1-en-3-yl carbonate |
| PubChem CID | 86041216 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl undec-1-en-3-yl carbonate |
| SMILES | C=CC(CCCCCCCC)OC(=O)OC |
| InChI | InChI=1S/C13H24O3/c1-4-6-7-8-9-10-11-12(5-2)16-13(14)15-3/h5,12H,2,4,6-11H2,1,3H3 |
| InChIKey | LLUAGYSSQLGLSL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl undec-1-en-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl undec-1-en-3-yl carbonate?
The IUPAC name of methyl undec-1-en-3-yl carbonate (CID 86041216) is methyl undec-1-en-3-yl carbonate.
What is the SMILES notation for methyl undec-1-en-3-yl carbonate?
The canonical SMILES for methyl undec-1-en-3-yl carbonate is C=CC(CCCCCCCC)OC(=O)OC.
What is the InChIKey of methyl undec-1-en-3-yl carbonate?
The InChIKey is LLUAGYSSQLGLSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-4-6-7-8-9-10-11-12(5-2)16-13(14)15-3/h5,12H,2,4,6-11H2,1,3H3.
What are the key properties of methyl undec-1-en-3-yl carbonate?
methyl undec-1-en-3-yl carbonate has a molecular weight of 228.33 g/mol, XLogP of 4.07, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl undec-1-en-3-yl carbonate is sourced from PubChem (CID 86041216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).