C9H12O4 — CID 101251655
methyl (E)-3-[(2R,3S)-3-acetyl-2-methyloxiran-2-yl]prop-2-enoate (PubChem CID 101251655) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl (E)-3-[(2R,3S)-3-acetyl-2-methyloxiran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,3S)-3-acetyl-2-methyloxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101251655 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | methyl (E)-3-[(2R,3S)-3-acetyl-2-methyloxiran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@]1(C)O[C@@H]1C(C)=O |
| InChI | InChI=1S/C9H12O4/c1-6(10)8-9(2,13-8)5-4-7(11)12-3/h4-5,8H,1-3H3/b5-4+/t8-,9-/m1/s1 |
| InChIKey | BJMOTCXDETWBGG-HOMPQPGZSA-N |
| XLogP | 0.46 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|