C12H18O4 — CID 10609284
ethyl (E)-5-(3-acetyl-2-methyloxiran-2-yl)pent-2-enoate (PubChem CID 10609284) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl (E)-5-(3-acetyl-2-methyloxiran-2-yl)pent-2-enoate.
| Compound Name | ethyl (E)-5-(3-acetyl-2-methyloxiran-2-yl)pent-2-enoate |
|---|---|
| PubChem CID | 10609284 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | ethyl (E)-5-(3-acetyl-2-methyloxiran-2-yl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/CCC1(C)OC1C(C)=O |
| InChI | InChI=1S/C12H18O4/c1-4-15-10(14)7-5-6-8-12(3)11(16-12)9(2)13/h5,7,11H,4,6,8H2,1-3H3/b7-5+ |
| InChIKey | VDWXVMTXDASGEO-FNORWQNLSA-N |
| XLogP | 1.63 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|