C15H22O6 — CID 15359271
ethyl (E)-5-[3-(4-methoxy-4-oxobutanoyl)-2-methyloxiran-2-yl]pent-2-enoate (PubChem CID 15359271) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl (E)-5-[3-(4-methoxy-4-oxobutanoyl)-2-methyloxiran-2-yl]pent-2-enoate.
| Compound Name | ethyl (E)-5-[3-(4-methoxy-4-oxobutanoyl)-2-methyloxiran-2-yl]pent-2-enoate |
|---|---|
| PubChem CID | 15359271 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl (E)-5-[3-(4-methoxy-4-oxobutanoyl)-2-methyloxiran-2-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/CCC1(C)OC1C(=O)CCC(=O)OC |
| InChI | InChI=1S/C15H22O6/c1-4-20-13(18)7-5-6-10-15(2)14(21-15)11(16)8-9-12(17)19-3/h5,7,14H,4,6,8-10H2,1-3H3/b7-5+ |
| InChIKey | WWOAAGCGOXDMEN-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|