C20H28O6 — CID 44518135
(1R,3S,5S,7E,9S,13R)-9-hydroperoxy-5,9,13-trimethyl-16-methylidene-4,14-dioxatricyclo[11.3.2.03,5]octadec-7-ene-12,15-dione (PubChem CID 44518135) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (1R,3S,5S,7E,9S,13R)-9-hydroperoxy-5,9,13-trimethyl-16-methylidene-4,14-dioxatricyclo[11.3.2.03,5]octadec-7-ene-12,15-dione.
| Compound Name | (1R,3S,5S,7E,9S,13R)-9-hydroperoxy-5,9,13-trimethyl-16-methylidene-4,14-dioxatricyclo[11.3.2.03,5]octadec-7-ene-12,15-dione |
|---|---|
| PubChem CID | 44518135 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1R,3S,5S,7E,9S,13R)-9-hydroperoxy-5,9,13-trimethyl-16-methylidene-4,14-dioxatricyclo[11.3.2.03,5]octadec-7-ene-12,15-dione |
| SMILES | C=C1C(=O)O[C@]2(C)CC[C@@H]1C[C@@H]1O[C@@]1(C)C/C=C/[C@@](C)(OO)CCC2=O |
| InChI | InChI=1S/C20H28O6/c1-13-14-6-11-19(3,25-17(13)22)15(21)7-10-18(2,26-23)8-5-9-20(4)16(12-14)24-20/h5,8,14,16,23H,1,6-7,9-12H2,2-4H3/b8-5+/t14-,16+,18-,19-,20+/m1/s1 |
| InChIKey | WPTRRIXCZXIQKN-BEHRTGFESA-N |
| XLogP | 3.36 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|