C11H14O5 — CID 54579183
tert-butyl 2-(3,6-dioxopyran-2-yl)acetate (PubChem CID 54579183) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is tert-butyl 2-(3,6-dioxopyran-2-yl)acetate.
| Compound Name | tert-butyl 2-(3,6-dioxopyran-2-yl)acetate |
|---|---|
| PubChem CID | 54579183 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | tert-butyl 2-(3,6-dioxopyran-2-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1OC(=O)C=CC1=O |
| InChI | InChI=1S/C11H14O5/c1-11(2,3)16-10(14)6-8-7(12)4-5-9(13)15-8/h4-5,8H,6H2,1-3H3 |
| InChIKey | KWHVAUTZWFKZBH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |