C11H10O5 — CID 56623916
methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-1-carboxylate (PubChem CID 56623916) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-1-carboxylate.
| Compound Name | methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-1-carboxylate |
|---|---|
| PubChem CID | 56623916 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-1-carboxylate |
| SMILES | COC(=O)C1OCCC2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C11H10O5/c1-15-11(14)10-9-6(4-5-16-10)7(12)2-3-8(9)13/h2-3,10H,4-5H2,1H3 |
| InChIKey | ZUHLGYXKPOGMPV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|