C23H52NO8P2+ — CID 101251752
2-[[(2R)-2-(heptyl-hydroxy-oxidophosphaniumyl)oxy-3-octoxypropoxy]-hydroxy-oxidophosphaniumyl]oxyethyl-trimethylazanium (PubChem CID 101251752) has the molecular formula C23H52NO8P2+ and a molecular weight of 532.62 g/mol. Its IUPAC name is 2-[[(2R)-2-(heptyl-hydroxy-oxidophosphaniumyl)oxy-3-octoxypropoxy]-hydroxy-oxidophosphaniumyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-(heptyl-hydroxy-oxidophosphaniumyl)oxy-3-octoxypropoxy]-hydroxy-oxidophosphaniumyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 101251752 |
| Molecular Formula | C23H52NO8P2+ |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 2-[[(2R)-2-(heptyl-hydroxy-oxidophosphaniumyl)oxy-3-octoxypropoxy]-hydroxy-oxidophosphaniumyl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCOC[C@H](CO[P+]([O-])(O)OCC[N+](C)(C)C)O[P+]([O-])(O)CCCCCCC |
| InChI | InChI=1S/C23H51NO8P2/c1-6-8-10-12-13-15-18-29-21-23(32-33(25,26)20-16-14-11-9-7-2)22-31-34(27,28)30-19-17-24(3,4)5/h23H,6-22H2,1-5H3,(H-,25,26,27,28)/p+1/t23-/m1/s1 |
| InChIKey | IACNVHFOIJXJKO-HSZRJFAPSA-O |
| XLogP | 3.60 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|