C24H21NO — CID 101252964
(3R)-3-(2-methyl-1H-indol-3-yl)-1,3-diphenylpropan-1-one (PubChem CID 101252964) has the molecular formula C24H21NO and a molecular weight of 339.44 g/mol. Its IUPAC name is (3R)-3-(2-methyl-1H-indol-3-yl)-1,3-diphenylpropan-1-one.
| Compound Name | (3R)-3-(2-methyl-1H-indol-3-yl)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 101252964 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (3R)-3-(2-methyl-1H-indol-3-yl)-1,3-diphenylpropan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO/c1-17-24(20-14-8-9-15-22(20)25-17)21(18-10-4-2-5-11-18)16-23(26)19-12-6-3-7-13-19/h2-15,21,25H,16H2,1H3/t21-/m1/s1 |
| InChIKey | GLCFQWOPHHPMNP-OAQYLSRUSA-N |
| XLogP | 5.88 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|