C18H19NO2 — CID 102355251
(2R,3S)-3-(2-methyl-1H-indol-3-yl)-3-phenylpropane-1,2-diol (PubChem CID 102355251) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2R,3S)-3-(2-methyl-1H-indol-3-yl)-3-phenylpropane-1,2-diol.
| Compound Name | (2R,3S)-3-(2-methyl-1H-indol-3-yl)-3-phenylpropane-1,2-diol |
|---|---|
| PubChem CID | 102355251 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2R,3S)-3-(2-methyl-1H-indol-3-yl)-3-phenylpropane-1,2-diol |
| SMILES | Cc1[nH]c2ccccc2c1[C@H](c1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C18H19NO2/c1-12-17(14-9-5-6-10-15(14)19-12)18(16(21)11-20)13-7-3-2-4-8-13/h2-10,16,18-21H,11H2,1H3/t16-,18+/m0/s1 |
| InChIKey | PWEFIPJOGOJDRR-FUHWJXTLSA-N |
| XLogP | 2.96 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|