C12H15NO3 — CID 170819227
1-(2-methyl-1H-indol-3-yl)propane-1,2,3-triol (PubChem CID 170819227) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)propane-1,2,3-triol.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819227 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)propane-1,2,3-triol |
| SMILES | Cc1[nH]c2ccccc2c1C(O)C(O)CO |
| InChI | InChI=1S/C12H15NO3/c1-7-11(12(16)10(15)6-14)8-4-2-3-5-9(8)13-7/h2-5,10,12-16H,6H2,1H3 |
| InChIKey | FMXPVORUOJALMN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|