C15H20N2O2 — CID 140944818
(2S)-2-amino-3-(2-methyl-1H-indol-3-yl)hexanoic acid (PubChem CID 140944818) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-methyl-1H-indol-3-yl)hexanoic acid.
| Compound Name | (2S)-2-amino-3-(2-methyl-1H-indol-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 140944818 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2S)-2-amino-3-(2-methyl-1H-indol-3-yl)hexanoic acid |
| SMILES | CCCC(c1c(C)[nH]c2ccccc12)[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H20N2O2/c1-3-6-11(14(16)15(18)19)13-9(2)17-12-8-5-4-7-10(12)13/h4-5,7-8,11,14,17H,3,6,16H2,1-2H3,(H,18,19)/t11?,14-/m0/s1 |
| InChIKey | SGWQWWOJXKTXHK-IAXJKZSUSA-N |
| XLogP | 2.77 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|