C21H26N2O — CID 101253378
4-[(2R,3R,5S,6R)-6-ethenyl-3-ethoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline (PubChem CID 101253378) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-[(2R,3R,5S,6R)-6-ethenyl-3-ethoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline.
| Compound Name | 4-[(2R,3R,5S,6R)-6-ethenyl-3-ethoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline |
|---|---|
| PubChem CID | 101253378 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-[(2R,3R,5S,6R)-6-ethenyl-3-ethoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H](OCC)[C@H]2c1ccnc2ccccc12 |
| InChI | InChI=1S/C21H26N2O/c1-3-15-14-23-12-10-16(15)13-20(24-4-2)21(23)18-9-11-22-19-8-6-5-7-17(18)19/h3,5-9,11,15-16,20-21H,1,4,10,12-14H2,2H3/t15-,16-,20+,21+/m0/s1 |
| InChIKey | FXVRRBFHMDEXRW-LVNJIZSUSA-N |
| XLogP | 4.21 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|