C20H24N2O — CID 10957818
4-[(2R,3S,5S,6R)-6-ethenyl-3-methoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline (PubChem CID 10957818) has the molecular formula C20H24N2O and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-[(2R,3S,5S,6R)-6-ethenyl-3-methoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline.
| Compound Name | 4-[(2R,3S,5S,6R)-6-ethenyl-3-methoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline |
|---|---|
| PubChem CID | 10957818 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-[(2R,3S,5S,6R)-6-ethenyl-3-methoxy-1-azabicyclo[3.2.2]nonan-2-yl]quinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H](OC)[C@H]2c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H24N2O/c1-3-14-13-22-11-9-15(14)12-19(23-2)20(22)17-8-10-21-18-7-5-4-6-16(17)18/h3-8,10,14-15,19-20H,1,9,11-13H2,2H3/t14-,15-,19-,20+/m0/s1 |
| InChIKey | JJZMQFXUBWPIQB-HZVDNRATSA-N |
| XLogP | 3.82 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|