C26H26N2O2 — CID 101253380
[(2S,3S,5S,6R)-6-ethenyl-2-quinolin-4-yl-1-azabicyclo[3.2.2]nonan-3-yl] benzoate (PubChem CID 101253380) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-6-ethenyl-2-quinolin-4-yl-1-azabicyclo[3.2.2]nonan-3-yl] benzoate.
| Compound Name | [(2S,3S,5S,6R)-6-ethenyl-2-quinolin-4-yl-1-azabicyclo[3.2.2]nonan-3-yl] benzoate |
|---|---|
| PubChem CID | 101253380 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [(2S,3S,5S,6R)-6-ethenyl-2-quinolin-4-yl-1-azabicyclo[3.2.2]nonan-3-yl] benzoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H](OC(=O)c1ccccc1)[C@@H]2c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H26N2O2/c1-2-18-17-28-15-13-20(18)16-24(30-26(29)19-8-4-3-5-9-19)25(28)22-12-14-27-23-11-7-6-10-21(22)23/h2-12,14,18,20,24-25H,1,13,15-17H2/t18-,20-,24-,25-/m0/s1 |
| InChIKey | GETSBVMNCWNBKO-IYNDAXALSA-N |
| XLogP | 5.03 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|